C23H31N5O2 — CID 18566688
3-cyclopentyl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]propanamide (PubChem CID 18566688) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-cyclopentyl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 18566688 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 3-cyclopentyl-N-[4-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]phenyl]propanamide |
| SMILES | Cc1cc(N2CCOCC2)nc(Nc2ccc(NC(=O)CCC3CCCC3)cc2)n1 |
| InChI | InChI=1S/C23H31N5O2/c1-17-16-21(28-12-14-30-15-13-28)27-23(24-17)26-20-9-7-19(8-10-20)25-22(29)11-6-18-4-2-3-5-18/h7-10,16,18H,2-6,11-15H2,1H3,(H,25,29)(H,24,26,27) |
| InChIKey | WZDPPZHEJKKQKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |