C25H35N5O — CID 46267959
3-cyclohexyl-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]propanamide (PubChem CID 46267959) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-cyclohexyl-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 46267959 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | 3-cyclohexyl-N-[4-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]phenyl]propanamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)CCC3CCCCC3)cc2)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C25H35N5O/c1-19-26-23(18-24(27-19)30-16-6-3-7-17-30)28-21-11-13-22(14-12-21)29-25(31)15-10-20-8-4-2-5-9-20/h11-14,18,20H,2-10,15-17H2,1H3,(H,29,31)(H,26,27,28) |
| InChIKey | CLKMGNTZNQURLM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |