C23H26FN5O2 — CID 122288395
N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-fluoro-4-methoxybenzamide (PubChem CID 122288395) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-fluoro-4-methoxybenzamide.
| Compound Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 122288395 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-3-fluoro-4-methoxybenzamide |
| SMILES | CCN(CC)c1cc(C)nc(Nc2ccc(NC(=O)c3ccc(OC)c(F)c3)cc2)n1 |
| InChI | InChI=1S/C23H26FN5O2/c1-5-29(6-2)21-13-15(3)25-23(28-21)27-18-10-8-17(9-11-18)26-22(30)16-7-12-20(31-4)19(24)14-16/h7-14H,5-6H2,1-4H3,(H,26,30)(H,25,27,28) |
| InChIKey | OZIJANSXIZVDOT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |