C22H23N7O — CID 122288924
2-(1-methylindol-3-yl)-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide (PubChem CID 122288924) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-(1-methylindol-3-yl)-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122288924 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-(1-methylindol-3-yl)-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
| SMILES | Cn1cc(CC(=O)NCCNc2ccc(Nc3ccccn3)nn2)c2ccccc21 |
| InChI | InChI=1S/C22H23N7O/c1-29-15-16(17-6-2-3-7-18(17)29)14-22(30)25-13-12-24-20-9-10-21(28-27-20)26-19-8-4-5-11-23-19/h2-11,15H,12-14H2,1H3,(H,24,27)(H,25,30)(H,23,26,28) |
| InChIKey | JDWLZKXHCNLTOQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|