C16H20N6O — CID 122288891
2-cyclopropyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide (PubChem CID 122288891) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-cyclopropyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide.
| Compound Name | 2-cyclopropyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122288891 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-cyclopropyl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]acetamide |
| SMILES | O=C(CC1CC1)NCCNc1ccc(Nc2ccccn2)nn1 |
| InChI | InChI=1S/C16H20N6O/c23-16(11-12-4-5-12)19-10-9-18-14-6-7-15(22-21-14)20-13-3-1-2-8-17-13/h1-3,6-8,12H,4-5,9-11H2,(H,18,21)(H,19,23)(H,17,20,22) |
| InChIKey | IROIAIKAAGVTRN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|