C18H17F2N7O — CID 121064952
1-(3,5-difluorophenyl)-3-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]urea (PubChem CID 121064952) has the molecular formula C18H17F2N7O and a molecular weight of 385.38 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]urea |
|---|---|
| PubChem CID | 121064952 |
| Molecular Formula | C18H17F2N7O |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]urea |
| SMILES | O=C(NCCNc1ccc(Nc2ccccn2)nn1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C18H17F2N7O/c19-12-9-13(20)11-14(10-12)24-18(28)23-8-7-22-16-4-5-17(27-26-16)25-15-3-1-2-6-21-15/h1-6,9-11H,7-8H2,(H,22,26)(H,21,25,27)(H2,23,24,28) |
| InChIKey | RJPRCRYJBCTLRE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|