C24H20N6O2S — CID 122291729
N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]naphthalene-1-sulfonamide (PubChem CID 122291729) has the molecular formula C24H20N6O2S and a molecular weight of 456.53 g/mol. Its IUPAC name is N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]naphthalene-1-sulfonamide.
| Compound Name | N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 122291729 |
| Molecular Formula | C24H20N6O2S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[4-[(6-imidazol-1-yl-2-methylpyrimidin-4-yl)amino]phenyl]naphthalene-1-sulfonamide |
| SMILES | Cc1nc(Nc2ccc(NS(=O)(=O)c3cccc4ccccc34)cc2)cc(-n2ccnc2)n1 |
| InChI | InChI=1S/C24H20N6O2S/c1-17-26-23(15-24(27-17)30-14-13-25-16-30)28-19-9-11-20(12-10-19)29-33(31,32)22-8-4-6-18-5-2-3-7-21(18)22/h2-16,29H,1H3,(H,26,27,28) |
| InChIKey | WIQPYEJWRKYSPW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |