C24H19N5O3S — CID 122310258
N-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]naphthalene-1-sulfonamide (PubChem CID 122310258) has the molecular formula C24H19N5O3S and a molecular weight of 457.52 g/mol. Its IUPAC name is N-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]naphthalene-1-sulfonamide.
| Compound Name | N-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 122310258 |
| Molecular Formula | C24H19N5O3S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[4-(2-methyl-6-pyrazol-1-ylpyrimidin-4-yl)oxyphenyl]naphthalene-1-sulfonamide |
| SMILES | Cc1nc(Oc2ccc(NS(=O)(=O)c3cccc4ccccc34)cc2)cc(-n2cccn2)n1 |
| InChI | InChI=1S/C24H19N5O3S/c1-17-26-23(29-15-5-14-25-29)16-24(27-17)32-20-12-10-19(11-13-20)28-33(30,31)22-9-4-7-18-6-2-3-8-21(18)22/h2-16,28H,1H3 |
| InChIKey | MLHMQGFOORNZPX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |