C21H15F3N6O — CID 122291877
2,3,4-trifluoro-N-[4-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]phenyl]benzamide (PubChem CID 122291877) has the molecular formula C21H15F3N6O and a molecular weight of 424.39 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]phenyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[4-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 122291877 |
| Molecular Formula | C21H15F3N6O |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-[[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]amino]phenyl]benzamide |
| SMILES | Cc1nccn1-c1cc(Nc2ccc(NC(=O)c3ccc(F)c(F)c3F)cc2)ncn1 |
| InChI | InChI=1S/C21H15F3N6O/c1-12-25-8-9-30(12)18-10-17(26-11-27-18)28-13-2-4-14(5-3-13)29-21(31)15-6-7-16(22)20(24)19(15)23/h2-11H,1H3,(H,29,31)(H,26,27,28) |
| InChIKey | MQLNGEGFNXCQAH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|