C14H12FN5 — CID 154829351
N-(4-fluorophenyl)-6-(2-methylimidazol-1-yl)pyrimidin-4-amine (PubChem CID 154829351) has the molecular formula C14H12FN5 and a molecular weight of 269.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-(2-methylimidazol-1-yl)pyrimidin-4-amine.
| Compound Name | N-(4-fluorophenyl)-6-(2-methylimidazol-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 154829351 |
| Molecular Formula | C14H12FN5 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(4-fluorophenyl)-6-(2-methylimidazol-1-yl)pyrimidin-4-amine |
| SMILES | Cc1nccn1-c1cc(Nc2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C14H12FN5/c1-10-16-6-7-20(10)14-8-13(17-9-18-14)19-12-4-2-11(15)3-5-12/h2-9H,1H3,(H,17,18,19) |
| InChIKey | SIUQXKIKSBHDAC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |