C18H25N7O2 — CID 122293721
2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 122293721) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is 2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122293721 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | Cc1nc(NCCNC(=O)Cn2cnc(C3CC3)cc2=O)cc(N(C)C)n1 |
| InChI | InChI=1S/C18H25N7O2/c1-12-22-15(9-16(23-12)24(2)3)19-6-7-20-17(26)10-25-11-21-14(8-18(25)27)13-4-5-13/h8-9,11,13H,4-7,10H2,1-3H3,(H,20,26)(H,19,22,23) |
| InChIKey | ANWVJRVMCLVIBC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|