C23H27N7O2 — CID 122325150
2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide (PubChem CID 122325150) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide.
| Compound Name | 2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122325150 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-(4-cyclopropyl-6-oxopyrimidin-1-yl)-N-[2-[[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]amino]ethyl]acetamide |
| SMILES | Cc1ccc(Nc2cc(C)nc(NCCNC(=O)Cn3cnc(C4CC4)cc3=O)n2)cc1 |
| InChI | InChI=1S/C23H27N7O2/c1-15-3-7-18(8-4-15)28-20-11-16(2)27-23(29-20)25-10-9-24-21(31)13-30-14-26-19(12-22(30)32)17-5-6-17/h3-4,7-8,11-12,14,17H,5-6,9-10,13H2,1-2H3,(H,24,31)(H2,25,27,28,29) |
| InChIKey | GHQJOPJGJZIQRU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|