C24H29N5O3 — CID 122294106
2-ethoxy-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]naphthalene-1-carboxamide (PubChem CID 122294106) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]naphthalene-1-carboxamide.
| Compound Name | 2-ethoxy-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 122294106 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 2-ethoxy-N-[2-[(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)amino]ethyl]naphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NCCNc1cc(N2CCOCC2)nc(C)n1 |
| InChI | InChI=1S/C24H29N5O3/c1-3-32-20-9-8-18-6-4-5-7-19(18)23(20)24(30)26-11-10-25-21-16-22(28-17(2)27-21)29-12-14-31-15-13-29/h4-9,16H,3,10-15H2,1-2H3,(H,26,30)(H,25,27,28) |
| InChIKey | BWQVRQLQHOAMPP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|