C19H24N6O3S — CID 122295064
1-(1,2-benzoxazol-3-yl)-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]methanesulfonamide (PubChem CID 122295064) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]methanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 122295064 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-[2-[(4-methyl-6-pyrrolidin-1-ylpyrimidin-2-yl)amino]ethyl]methanesulfonamide |
| SMILES | Cc1cc(N2CCCC2)nc(NCCNS(=O)(=O)Cc2noc3ccccc23)n1 |
| InChI | InChI=1S/C19H24N6O3S/c1-14-12-18(25-10-4-5-11-25)23-19(22-14)20-8-9-21-29(26,27)13-16-15-6-2-3-7-17(15)28-24-16/h2-3,6-7,12,21H,4-5,8-11,13H2,1H3,(H,20,22,23) |
| InChIKey | WDRYRAREBQGYPO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|