C19H21N5O3 — CID 122295406
N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-oxochromene-2-carboxamide (PubChem CID 122295406) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 122295406 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[2-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]ethyl]-4-oxochromene-2-carboxamide |
| SMILES | Cc1cc(N(C)C)nc(NCCNC(=O)c2cc(=O)c3ccccc3o2)n1 |
| InChI | InChI=1S/C19H21N5O3/c1-12-10-17(24(2)3)23-19(22-12)21-9-8-20-18(26)16-11-14(25)13-6-4-5-7-15(13)27-16/h4-7,10-11H,8-9H2,1-3H3,(H,20,26)(H,21,22,23) |
| InChIKey | KHQLKYBDHQNKDI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|