C21H23N5O4 — CID 122295157
N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-4-oxochromene-2-carboxamide (PubChem CID 122295157) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 122295157 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-4-oxochromene-2-carboxamide |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)c2cc(=O)c3ccccc3o2)n1 |
| InChI | InChI=1S/C21H23N5O4/c1-14-12-19(26-8-10-29-11-9-26)25-21(24-14)23-7-6-22-20(28)18-13-16(27)15-4-2-3-5-17(15)30-18/h2-5,12-13H,6-11H2,1H3,(H,22,28)(H,23,24,25) |
| InChIKey | MFXZKDSBKNGZND-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|