C19H18N4O4 — CID 122353411
N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-oxochromene-2-carboxamide (PubChem CID 122353411) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 122353411 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(NCc1ccnc(N2CCOCC2)n1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H18N4O4/c24-15-11-17(27-16-4-2-1-3-14(15)16)18(25)21-12-13-5-6-20-19(22-13)23-7-9-26-10-8-23/h1-6,11H,7-10,12H2,(H,21,25) |
| InChIKey | ZKFPSBQJTZQMFD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |