C16H16F2N4O2 — CID 91967358
2,6-difluoro-N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]benzamide (PubChem CID 91967358) has the molecular formula C16H16F2N4O2 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2,6-difluoro-N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]benzamide.
| Compound Name | 2,6-difluoro-N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 91967358 |
| Molecular Formula | C16H16F2N4O2 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2,6-difluoro-N-[(2-morpholin-4-ylpyrimidin-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccnc(N2CCOCC2)n1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H16F2N4O2/c17-12-2-1-3-13(18)14(12)15(23)20-10-11-4-5-19-16(21-11)22-6-8-24-9-7-22/h1-5H,6-10H2,(H,20,23) |
| InChIKey | FANOAABWAMZVDI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |