C17H19F2N5O — CID 122353062
1-(2,6-difluorophenyl)-3-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]urea (PubChem CID 122353062) has the molecular formula C17H19F2N5O and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]urea |
|---|---|
| PubChem CID | 122353062 |
| Molecular Formula | C17H19F2N5O |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]urea |
| SMILES | O=C(NCc1ccnc(N2CCCCC2)n1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H19F2N5O/c18-13-5-4-6-14(19)15(13)23-17(25)21-11-12-7-8-20-16(22-12)24-9-2-1-3-10-24/h4-8H,1-3,9-11H2,(H2,21,23,25) |
| InChIKey | XYOWATPQKVEXSY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |