C17H17F3N4O — CID 122353165
2,3,4-trifluoro-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]benzamide (PubChem CID 122353165) has the molecular formula C17H17F3N4O and a molecular weight of 350.34 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122353165 |
| Molecular Formula | C17H17F3N4O |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2,3,4-trifluoro-N-[(2-piperidin-1-ylpyrimidin-4-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccnc(N2CCCCC2)n1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H17F3N4O/c18-13-5-4-12(14(19)15(13)20)16(25)22-10-11-6-7-21-17(23-11)24-8-2-1-3-9-24/h4-7H,1-3,8-10H2,(H,22,25) |
| InChIKey | CUJVXQCQNLXFQS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|