C21H21N9O — CID 122296448
N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(tetrazol-1-yl)benzamide (PubChem CID 122296448) has the molecular formula C21H21N9O and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(tetrazol-1-yl)benzamide.
| Compound Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122296448 |
| Molecular Formula | C21H21N9O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(tetrazol-1-yl)benzamide |
| SMILES | Cc1nc(Nc2ccc(NC(=O)c3cccc(-n4cnnn4)c3)cc2)cc(N(C)C)n1 |
| InChI | InChI=1S/C21H21N9O/c1-14-23-19(12-20(24-14)29(2)3)25-16-7-9-17(10-8-16)26-21(31)15-5-4-6-18(11-15)30-13-22-27-28-30/h4-13H,1-3H3,(H,26,31)(H,23,24,25) |
| InChIKey | GBPQVFPWXOHLKC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |