C20H27N5O — CID 122298783
1-(4-tert-butylphenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea (PubChem CID 122298783) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122298783 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2cnc(N3CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C20H27N5O/c1-20(2,3)15-7-9-16(10-8-15)23-19(26)24-17-13-21-18(22-14-17)25-11-5-4-6-12-25/h7-10,13-14H,4-6,11-12H2,1-3H3,(H2,23,24,26) |
| InChIKey | FRUWNPHRVJAASJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |