C16H17F2N5O — CID 122298481
1-(3,5-difluorophenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea (PubChem CID 122298481) has the molecular formula C16H17F2N5O and a molecular weight of 333.34 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea |
|---|---|
| PubChem CID | 122298481 |
| Molecular Formula | C16H17F2N5O |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(2-piperidin-1-ylpyrimidin-5-yl)urea |
| SMILES | O=C(Nc1cnc(N2CCCCC2)nc1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H17F2N5O/c17-11-6-12(18)8-13(7-11)21-16(24)22-14-9-19-15(20-10-14)23-4-2-1-3-5-23/h6-10H,1-5H2,(H2,21,22,24) |
| InChIKey | XOEABKABSLPFTF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |