C20H19F2N5O2S — CID 122299454
3,5-difluoro-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]benzenesulfonamide (PubChem CID 122299454) has the molecular formula C20H19F2N5O2S and a molecular weight of 431.47 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 122299454 |
| Molecular Formula | C20H19F2N5O2S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3,5-difluoro-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cnc(N2CCN(c3ccccc3)CC2)nc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C20H19F2N5O2S/c21-15-10-16(22)12-19(11-15)30(28,29)25-17-13-23-20(24-14-17)27-8-6-26(7-9-27)18-4-2-1-3-5-18/h1-5,10-14,25H,6-9H2 |
| InChIKey | NBQXQYTWKGPWHL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |