C20H25N7O2S — CID 122299488
1-ethyl-2-methyl-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]imidazole-4-sulfonamide (PubChem CID 122299488) has the molecular formula C20H25N7O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 1-ethyl-2-methyl-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]imidazole-4-sulfonamide.
| Compound Name | 1-ethyl-2-methyl-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 122299488 |
| Molecular Formula | C20H25N7O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-ethyl-2-methyl-N-[2-(4-phenylpiperazin-1-yl)pyrimidin-5-yl]imidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2cnc(N3CCN(c4ccccc4)CC3)nc2)nc1C |
| InChI | InChI=1S/C20H25N7O2S/c1-3-25-15-19(23-16(25)2)30(28,29)24-17-13-21-20(22-14-17)27-11-9-26(10-12-27)18-7-5-4-6-8-18/h4-8,13-15,24H,3,9-12H2,1-2H3 |
| InChIKey | FXFHDKFZCAPRCM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |