C14H18BrN3O2S — CID 114295509
N-(2-bromo-2-phenylethyl)-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 114295509) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is N-(2-bromo-2-phenylethyl)-1-ethyl-2-methylimidazole-4-sulfonamide.
| Compound Name | N-(2-bromo-2-phenylethyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 114295509 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-(2-bromo-2-phenylethyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(Br)c2ccccc2)nc1C |
| InChI | InChI=1S/C14H18BrN3O2S/c1-3-18-10-14(17-11(18)2)21(19,20)16-9-13(15)12-7-5-4-6-8-12/h4-8,10,13,16H,3,9H2,1-2H3 |
| InChIKey | QBNLUEFLPLUYMF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|