C10H20N4O3S — CID 64539580
N-(2-amino-3-hydroxybutyl)-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 64539580) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-(2-amino-3-hydroxybutyl)-1-ethyl-2-methylimidazole-4-sulfonamide.
| Compound Name | N-(2-amino-3-hydroxybutyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 64539580 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(2-amino-3-hydroxybutyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(N)C(C)O)nc1C |
| InChI | InChI=1S/C10H20N4O3S/c1-4-14-6-10(13-8(14)3)18(16,17)12-5-9(11)7(2)15/h6-7,9,12,15H,4-5,11H2,1-3H3 |
| InChIKey | OBAROJNNKVSOIF-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |