C9H16ClN3O2S — CID 65030909
N-(1-chloropropan-2-yl)-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 65030909) has the molecular formula C9H16ClN3O2S and a molecular weight of 265.77 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-1-ethyl-2-methylimidazole-4-sulfonamide.
| Compound Name | N-(1-chloropropan-2-yl)-1-ethyl-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 65030909 |
| Molecular Formula | C9H16ClN3O2S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(1-chloropropan-2-yl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC(C)CCl)nc1C |
| InChI | InChI=1S/C9H16ClN3O2S/c1-4-13-6-9(11-8(13)3)16(14,15)12-7(2)5-10/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | MPWYWLVHBUVJMR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|