C12H22ClN3O2S — CID 106145989
N-(4-chloro-2,2-dimethylbutyl)-1-ethyl-2-methylimidazole-4-sulfonamide (PubChem CID 106145989) has the molecular formula C12H22ClN3O2S and a molecular weight of 307.85 g/mol. Its IUPAC name is N-(4-chloro-2,2-dimethylbutyl)-1-ethyl-2-methylimidazole-4-sulfonamide.
| Compound Name | N-(4-chloro-2,2-dimethylbutyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 106145989 |
| Molecular Formula | C12H22ClN3O2S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(4-chloro-2,2-dimethylbutyl)-1-ethyl-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(C)(C)CCCl)nc1C |
| InChI | InChI=1S/C12H22ClN3O2S/c1-5-16-8-11(15-10(16)2)19(17,18)14-9-12(3,4)6-7-13/h8,14H,5-7,9H2,1-4H3 |
| InChIKey | JPDHLFYKCKDRPA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|