C9H16N4O2S2 — CID 62666905
3-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]propanethioamide (PubChem CID 62666905) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 3-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]propanethioamide.
| Compound Name | 3-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]propanethioamide |
|---|---|
| PubChem CID | 62666905 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 3-[(1-ethyl-2-methylimidazol-4-yl)sulfonylamino]propanethioamide |
| SMILES | CCn1cc(S(=O)(=O)NCCC(N)=S)nc1C |
| InChI | InChI=1S/C9H16N4O2S2/c1-3-13-6-9(12-7(13)2)17(14,15)11-5-4-8(10)16/h6,11H,3-5H2,1-2H3,(H2,10,16) |
| InChIKey | IDXANZVKTWUBJK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|