About 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide
1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide (PubChem CID 97252609) has the molecular formula C17H25N3O3S
and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide |
| PubChem CID | 97252609 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NC[C@@H](C[C@H](C)O)c2ccccc2)nc1C |
| InChI | InChI=1S/C17H25N3O3S/c1-4-20-12-17(19-14(20)3)24(22,23)18-11-16(10-13(2)21)15-8-6-5-7-9-15/h5-9,12-13,16,18,21H,4,10-11H2,1-3H3/t13-,16+/m0/s1 |
| InChIKey | WVZLQPFJYQGHRG-XJKSGUPXSA-N |
| XLogP | 2.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide?
The IUPAC name of 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide (CID 97252609) is 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide.
What is the SMILES notation for 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide?
The canonical SMILES for 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide is CCn1cc(S(=O)(=O)NC[C@@H](C[C@H](C)O)c2ccccc2)nc1C.
What is the InChIKey of 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide?
The InChIKey is WVZLQPFJYQGHRG-XJKSGUPXSA-N. The full InChI is InChI=1S/C17H25N3O3S/c1-4-20-12-17(19-14(20)3)24(22,23)18-11-16(10-13(2)21)15-8-6-5-7-9-15/h5-9,12-13,16,18,21H,4,10-11H2,1-3H3/t13-,16+/m0/s1.
What are the key properties of 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide?
1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide has a molecular weight of 351.47 g/mol, XLogP of 2.04, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-[(2S,4S)-4-hydroxy-2-phenylpentyl]-2-methylimidazole-4-sulfonamide is sourced from PubChem (CID 97252609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).