C14H14N4O4 — CID 122302915
N-(2-methoxy-4,6-dimethylpyrimidin-5-yl)-2-nitrobenzamide (PubChem CID 122302915) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-(2-methoxy-4,6-dimethylpyrimidin-5-yl)-2-nitrobenzamide.
| Compound Name | N-(2-methoxy-4,6-dimethylpyrimidin-5-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 122302915 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-(2-methoxy-4,6-dimethylpyrimidin-5-yl)-2-nitrobenzamide |
| SMILES | COc1nc(C)c(NC(=O)c2ccccc2[N+](=O)[O-])c(C)n1 |
| InChI | InChI=1S/C14H14N4O4/c1-8-12(9(2)16-14(15-8)22-3)17-13(19)10-6-4-5-7-11(10)18(20)21/h4-7H,1-3H3,(H,17,19) |
| InChIKey | AUVHRCMENXGQOM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|