C20H18FN3O2 — CID 122303223
N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-4-methylbenzamide (PubChem CID 122303223) has the molecular formula C20H18FN3O2 and a molecular weight of 351.38 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-4-methylbenzamide.
| Compound Name | N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 122303223 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[2-(2-fluorophenoxy)-4,6-dimethylpyrimidin-5-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2c(C)nc(Oc3ccccc3F)nc2C)cc1 |
| InChI | InChI=1S/C20H18FN3O2/c1-12-8-10-15(11-9-12)19(25)24-18-13(2)22-20(23-14(18)3)26-17-7-5-4-6-16(17)21/h4-11H,1-3H3,(H,24,25) |
| InChIKey | YCMKZGARAQNZBC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |