C15H17N3O3S — CID 122304392
(E)-N-(2,4-diethoxypyrimidin-5-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 122304392) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is (E)-N-(2,4-diethoxypyrimidin-5-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(2,4-diethoxypyrimidin-5-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 122304392 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (E)-N-(2,4-diethoxypyrimidin-5-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCOc1ncc(NC(=O)/C=C/c2cccs2)c(OCC)n1 |
| InChI | InChI=1S/C15H17N3O3S/c1-3-20-14-12(10-16-15(18-14)21-4-2)17-13(19)8-7-11-6-5-9-22-11/h5-10H,3-4H2,1-2H3,(H,17,19)/b8-7+ |
| InChIKey | PNUWSAIJCWWKBB-BQYQJAHWSA-N |
| XLogP | 2.99 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|