C16H17F3N4O3 — CID 122304590
1-(2,4-diethoxypyrimidin-5-yl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 122304590) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 1-(2,4-diethoxypyrimidin-5-yl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2,4-diethoxypyrimidin-5-yl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 122304590 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-(2,4-diethoxypyrimidin-5-yl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1ncc(NC(=O)Nc2ccccc2C(F)(F)F)c(OCC)n1 |
| InChI | InChI=1S/C16H17F3N4O3/c1-3-25-13-12(9-20-15(23-13)26-4-2)22-14(24)21-11-8-6-5-7-10(11)16(17,18)19/h5-9H,3-4H2,1-2H3,(H2,21,22,24) |
| InChIKey | YYEMDRXQZMUPCN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |