C17H14N8O2 — CID 122304842
1-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]triazole-4-carboxamide (PubChem CID 122304842) has the molecular formula C17H14N8O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]triazole-4-carboxamide.
| Compound Name | 1-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122304842 |
| Molecular Formula | C17H14N8O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-methyl-N-[4-(6-pyrazol-1-ylpyridazin-3-yl)oxyphenyl]triazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(Oc3ccc(-n4cccn4)nn3)cc2)nn1 |
| InChI | InChI=1S/C17H14N8O2/c1-24-11-14(20-23-24)17(26)19-12-3-5-13(6-4-12)27-16-8-7-15(21-22-16)25-10-2-9-18-25/h2-11H,1H3,(H,19,26) |
| InChIKey | VDPGJGFAFQWBDY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |