C17H15N9O — CID 122290639
1-methyl-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]triazole-4-carboxamide (PubChem CID 122290639) has the molecular formula C17H15N9O and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-methyl-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]triazole-4-carboxamide.
| Compound Name | 1-methyl-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 122290639 |
| Molecular Formula | C17H15N9O |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-methyl-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]triazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(Nc3cc(-n4cccn4)ncn3)cc2)nn1 |
| InChI | InChI=1S/C17H15N9O/c1-25-10-14(23-24-25)17(27)22-13-5-3-12(4-6-13)21-15-9-16(19-11-18-15)26-8-2-7-20-26/h2-11H,1H3,(H,22,27)(H,18,19,21) |
| InChIKey | LOCAKRLGFOZXRM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |