C22H17ClN6O — CID 122290582
(E)-3-(2-chlorophenyl)-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 122290582) has the molecular formula C22H17ClN6O and a molecular weight of 416.87 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122290582 |
| Molecular Formula | C22H17ClN6O |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[(6-pyrazol-1-ylpyrimidin-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1ccc(Nc2cc(-n3cccn3)ncn2)cc1 |
| InChI | InChI=1S/C22H17ClN6O/c23-19-5-2-1-4-16(19)6-11-22(30)28-18-9-7-17(8-10-18)27-20-14-21(25-15-24-20)29-13-3-12-26-29/h1-15H,(H,28,30)(H,24,25,27)/b11-6+ |
| InChIKey | JFJNJVOHBZENHP-IZZDOVSWSA-N |
| XLogP | 4.71 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|