C10H10N4O2 — CID 136716966
N-(4-hydroxyphenyl)-1-methyltriazole-4-carboxamide (PubChem CID 136716966) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-1-methyltriazole-4-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-1-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 136716966 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | N-(4-hydroxyphenyl)-1-methyltriazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(O)cc2)nn1 |
| InChI | InChI=1S/C10H10N4O2/c1-14-6-9(12-13-14)10(16)11-7-2-4-8(15)5-3-7/h2-6,15H,1H3,(H,11,16) |
| InChIKey | RJMBSEPOYXVDJI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|