C23H26N6O2 — CID 122307370
1-(3,4-dimethylphenyl)-5-oxo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 122307370) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5-oxo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)-5-oxo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122307370 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5-oxo-N-[2-[(6-pyrrol-1-ylpyridazin-3-yl)amino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)NCCNc3ccc(-n4cccc4)nn3)CC2=O)cc1C |
| InChI | InChI=1S/C23H26N6O2/c1-16-5-6-19(13-17(16)2)29-15-18(14-22(29)30)23(31)25-10-9-24-20-7-8-21(27-26-20)28-11-3-4-12-28/h3-8,11-13,18H,9-10,14-15H2,1-2H3,(H,24,26)(H,25,31) |
| InChIKey | JKCRMZDILQYITD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|