C23H24FN7O2 — CID 122326857
1-(4-fluorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 122326857) has the molecular formula C23H24FN7O2 and a molecular weight of 449.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122326857 |
| Molecular Formula | C23H24FN7O2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[2-[[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(NCCNC(=O)C3CC(=O)N(c4ccc(F)cc4)C3)nn2)nc1 |
| InChI | InChI=1S/C23H24FN7O2/c1-15-2-7-19(27-13-15)28-21-9-8-20(29-30-21)25-10-11-26-23(33)16-12-22(32)31(14-16)18-5-3-17(24)4-6-18/h2-9,13,16H,10-12,14H2,1H3,(H,25,29)(H,26,33)(H,27,28,30) |
| InChIKey | IBLUZWJHCJWMAG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|