C22H28N6O3 — CID 122321567
1-(4-methylphenyl)-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 122321567) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122321567 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-(4-methylphenyl)-N-[2-[(5-morpholin-4-ylpyridazin-3-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)NCCNc3cc(N4CCOCC4)cnn3)CC2=O)cc1 |
| InChI | InChI=1S/C22H28N6O3/c1-16-2-4-18(5-3-16)28-15-17(12-21(28)29)22(30)24-7-6-23-20-13-19(14-25-26-20)27-8-10-31-11-9-27/h2-5,13-14,17H,6-12,15H2,1H3,(H,23,26)(H,24,30) |
| InChIKey | FQMPEJZLSUCRAY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|