C24H32N6O2 — CID 122326458
1-(4-methylphenyl)-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 122326458) has the molecular formula C24H32N6O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122326458 |
| Molecular Formula | C24H32N6O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 1-(4-methylphenyl)-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC(C(=O)NCCNc3cc(N4CCCCC4)nc(C)n3)CC2=O)cc1 |
| InChI | InChI=1S/C24H32N6O2/c1-17-6-8-20(9-7-17)30-16-19(14-23(30)31)24(32)26-11-10-25-21-15-22(28-18(2)27-21)29-12-4-3-5-13-29/h6-9,15,19H,3-5,10-14,16H2,1-2H3,(H,26,32)(H,25,27,28) |
| InChIKey | RCVZDCCXKSGWEC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|