C22H27ClN6O3 — CID 122295155
1-(4-chlorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 122295155) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122295155 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1cc(N2CCOCC2)nc(NCCNC(=O)C2CC(=O)N(c3ccc(Cl)cc3)C2)n1 |
| InChI | InChI=1S/C22H27ClN6O3/c1-15-12-19(28-8-10-32-11-9-28)27-22(26-15)25-7-6-24-21(31)16-13-20(30)29(14-16)18-4-2-17(23)3-5-18/h2-5,12,16H,6-11,13-14H2,1H3,(H,24,31)(H,25,26,27) |
| InChIKey | UUSFMBKDOMVQPM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|