C20H25FN6O2 — CID 122325404
N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 122325404) has the molecular formula C20H25FN6O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122325404 |
| Molecular Formula | C20H25FN6O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[2-[[2-(ethylamino)-6-methylpyrimidin-4-yl]amino]ethyl]-1-(4-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCNc1nc(C)cc(NCCNC(=O)C2CC(=O)N(c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C20H25FN6O2/c1-3-22-20-25-13(2)10-17(26-20)23-8-9-24-19(29)14-11-18(28)27(12-14)16-6-4-15(21)5-7-16/h4-7,10,14H,3,8-9,11-12H2,1-2H3,(H,24,29)(H2,22,23,25,26) |
| InChIKey | UXFIDLRWEXUTKD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|