C22H22FN7O2 — CID 122288849
(3S)-1-(4-fluorophenyl)-5-oxo-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrrolidine-3-carboxamide (PubChem CID 122288849) has the molecular formula C22H22FN7O2 and a molecular weight of 435.46 g/mol. Its IUPAC name is (3S)-1-(4-fluorophenyl)-5-oxo-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-fluorophenyl)-5-oxo-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122288849 |
| Molecular Formula | C22H22FN7O2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (3S)-1-(4-fluorophenyl)-5-oxo-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNc1ccc(Nc2ccccn2)nn1)[C@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H22FN7O2/c23-16-4-6-17(7-5-16)30-14-15(13-21(30)31)22(32)26-12-11-25-19-8-9-20(29-28-19)27-18-3-1-2-10-24-18/h1-10,15H,11-14H2,(H,25,28)(H,26,32)(H,24,27,29)/t15-/m0/s1 |
| InChIKey | SGPQKVIMEGZRNQ-HNNXBMFYSA-N |
| XLogP | 2.34 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|