C23H19N7O6 — CID 122310691
N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-3,5-dinitrobenzamide (PubChem CID 122310691) has the molecular formula C23H19N7O6 and a molecular weight of 489.45 g/mol. Its IUPAC name is N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 122310691 |
| Molecular Formula | C23H19N7O6 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]oxyphenyl]-3,5-dinitrobenzamide |
| SMILES | Cc1cc(C)n(-c2cc(Oc3ccc(NC(=O)c4cc([N+](=O)[O-])cc([N+](=O)[O-])c4)cc3)nc(C)n2)n1 |
| InChI | InChI=1S/C23H19N7O6/c1-13-8-14(2)28(27-13)21-12-22(25-15(3)24-21)36-20-6-4-17(5-7-20)26-23(31)16-9-18(29(32)33)11-19(10-16)30(34)35/h4-12H,1-3H3,(H,26,31) |
| InChIKey | ANUJGZIWERPSEB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|