C24H21ClN6O4 — CID 122311070
2-chloro-N-[4-[2-methyl-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-4-nitrobenzamide (PubChem CID 122311070) has the molecular formula C24H21ClN6O4 and a molecular weight of 492.92 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-methyl-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[2-methyl-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 122311070 |
| Molecular Formula | C24H21ClN6O4 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-chloro-N-[4-[2-methyl-6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-4-nitrobenzamide |
| SMILES | Cc1nc(Oc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)cc2)cc(-n2nc(C)c(C)c2C)n1 |
| InChI | InChI=1S/C24H21ClN6O4/c1-13-14(2)29-30(15(13)3)22-12-23(27-16(4)26-22)35-19-8-5-17(6-9-19)28-24(32)20-10-7-18(31(33)34)11-21(20)25/h5-12H,1-4H3,(H,28,32) |
| InChIKey | ULBWKMDZWMDQPU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|