C22H19N7O3S2 — CID 122311420
N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2,1,3-benzothiadiazole-4-sulfonamide (PubChem CID 122311420) has the molecular formula C22H19N7O3S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2,1,3-benzothiadiazole-4-sulfonamide.
| Compound Name | N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 122311420 |
| Molecular Formula | C22H19N7O3S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]-2,1,3-benzothiadiazole-4-sulfonamide |
| SMILES | Cc1nn(-c2cc(Oc3ccc(NS(=O)(=O)c4cccc5nsnc45)cc3)ncn2)c(C)c1C |
| InChI | InChI=1S/C22H19N7O3S2/c1-13-14(2)25-29(15(13)3)20-11-21(24-12-23-20)32-17-9-7-16(8-10-17)28-34(30,31)19-6-4-5-18-22(19)27-33-26-18/h4-12,28H,1-3H3 |
| InChIKey | RCNXOACZCZFULT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|