C22H20N6O5S — CID 122311453
3-nitro-N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]benzenesulfonamide (PubChem CID 122311453) has the molecular formula C22H20N6O5S and a molecular weight of 480.51 g/mol. Its IUPAC name is 3-nitro-N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122311453 |
| Molecular Formula | C22H20N6O5S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 3-nitro-N-[4-[6-(3,4,5-trimethylpyrazol-1-yl)pyrimidin-4-yl]oxyphenyl]benzenesulfonamide |
| SMILES | Cc1nn(-c2cc(Oc3ccc(NS(=O)(=O)c4cccc([N+](=O)[O-])c4)cc3)ncn2)c(C)c1C |
| InChI | InChI=1S/C22H20N6O5S/c1-14-15(2)25-27(16(14)3)21-12-22(24-13-23-21)33-19-9-7-17(8-10-19)26-34(31,32)20-6-4-5-18(11-20)28(29)30/h4-13,26H,1-3H3 |
| InChIKey | VZLUUWIJPOYDAY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|